CAS 6063-50-9 appears in our catalog under these names: N-Benzyl-2,2-dichloroacetamide, 95%, N-Benzyl-2,2-dichloroacetamide, 7-(((Cyclohexylmethyl)amino)methyl)-5-(methoxymethyl)quinolin-8-ol, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 10mg, 50mg, 5mg.
N-benzyl-2,2-dichloroacetamide (CAS 6063-50-9) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: N-benzyl-2,2-dichloroacetamide. InChIKey: FVSBKXQDYFGZIC-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | N-benzyl-2,2-dichloroacetamide |
| InChIKey | FVSBKXQDYFGZIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C(Cl)Cl |
Computed by PubChem (NCBI)