CAS 99585-99-6 is the registry number for (1E)-1-(2,5-Dichlorophenyl)propan-1-one oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(NE)-N-[1-(2,5-dichlorophenyl)propylidene]hydroxylamine (CAS 99585-99-6) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: (NE)-N-[1-(2,5-dichlorophenyl)propylidene]hydroxylamine. InChIKey: AUNLCDXZWHNEPS-FMIVXFBMSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | (NE)-N-[1-(2,5-dichlorophenyl)propylidene]hydroxylamine |
| InChIKey | AUNLCDXZWHNEPS-FMIVXFBMSA-N |
| SMILES | CC/C(=N\O)/C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)