CAS 33244-93-8 appears in our catalog under these names: 3,5-Dichloro-n-ethylbenzamide, 95%, 3,5-Dichloro-N-ethylbenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3,5-dichloro-N-ethylbenzamide (CAS 33244-93-8) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: 3,5-dichloro-N-ethylbenzamide. InChIKey: ZVJJAWHZUKVECT-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 3,5-dichloro-N-ethylbenzamide |
| InChIKey | ZVJJAWHZUKVECT-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)