Products 1399049-43-4
CAS 1399049-43-4 is the registry number for Drahebenine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methoxy-4-(2,2,5-trimethylimidazol-4-yl)phenol (CAS 1399049-43-4) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: 2-methoxy-4-(2,2,5-trimethylimidazol-4-yl)phenol. InChIKey: UBDFYAAYCZNGLQ-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 2-methoxy-4-(2,2,5-trimethylimidazol-4-yl)phenol |
| InChIKey | UBDFYAAYCZNGLQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(N=C1C2=CC(=C(C=C2)O)OC)(C)C |
Computed by PubChem (NCBI)