CAS 14002-52-9 appears in our catalog under these names: (1,1'-Biphenyl)-2-carbonyl chloride, 95-<97%, (1,1'-Biphenyl)-2-carbonyl chloride, ≥97-<99%, [1,1'-Biphenyl]-2-carbonyl Chloride, >98.0%(GC)(T), [1,1'-biphenyl]-2-carbonyl chloride, 98%(GC-MS),RG, 98%(GC-MS),RG. Offered by: Hoffman Fine Chemicals, TCI, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 200mg, 1g, 100mg.
2-phenylbenzoyl chloride (CAS 14002-52-9) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 2-phenylbenzoyl chloride. InChIKey: MPJOJCZVGBOVOV-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-phenylbenzoyl chloride |
| InChIKey | MPJOJCZVGBOVOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C(=O)Cl |
Computed by PubChem (NCBI)