CAS 1402138-64-0 is the registry number for 4-Bromo-6,8-dimethoxyquinoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6,8-dimethoxyquinoline (CAS 1402138-64-0) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 4-bromo-6,8-dimethoxyquinoline. InChIKey: ZQRPMMUHPNRCOH-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-bromo-6,8-dimethoxyquinoline |
| InChIKey | ZQRPMMUHPNRCOH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C(=C1)OC)Br |
Computed by PubChem (NCBI)