Products 1402150-27-9
CAS 1402150-27-9 is the registry number for Ticagrelor Impurity 202. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetic acid (CAS 1402150-27-9) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 2-[[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetic acid. InChIKey: GGMSRGXIOKTJTG-CRYJXSNHSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-[[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetic acid |
| InChIKey | GGMSRGXIOKTJTG-CRYJXSNHSA-N |
| SMILES | CC1(O[C@H]2[C@@H](C[C@@H]([C@H]2O1)OCC(=O)O)N)C |
Computed by PubChem (NCBI)
Synonyms:
Ticagrelor Impurity 202