Products 140233-65-4
CAS 140233-65-4 is the registry number for Benzyl 2-(4-(bromomethyl)phenyl)acetate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Benzyl 2-[4-(bromomethyl)phenyl]acetate (CAS 140233-65-4) is a chemical compound with the molecular formula C16H15BrO2 and a molecular weight of 319.19 g/mol. IUPAC name: benzyl 2-[4-(bromomethyl)phenyl]acetate. InChIKey: NULZSYVCOGJFJP-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO2 |
|---|---|
| Molecular weight | 319.19 g/mol |
| IUPAC name | benzyl 2-[4-(bromomethyl)phenyl]acetate |
| InChIKey | NULZSYVCOGJFJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)