Products 1402725-98-7
CAS 1402725-98-7 is the registry number for Rhodomyrtosone I. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,8-dihydroxy-2,2,4,4-tetramethyl-7-(3-methylbutanoyl)-9-phenyl-9H-xanthene-1,3-dione (CAS 1402725-98-7) is a chemical compound with the molecular formula C28H30O6 and a molecular weight of 462.5 g/mol. IUPAC name: 6,8-dihydroxy-2,2,4,4-tetramethyl-7-(3-methylbutanoyl)-9-phenyl-9H-xanthene-1,3-dione. InChIKey: IUCQPLXKIAOHNZ-UHFFFAOYSA-N.
| Molecular formula | C28H30O6 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | 6,8-dihydroxy-2,2,4,4-tetramethyl-7-(3-methylbutanoyl)-9-phenyl-9H-xanthene-1,3-dione |
| InChIKey | IUCQPLXKIAOHNZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=C(C2=C(C=C1O)OC3=C(C2C4=CC=CC=C4)C(=O)C(C(=O)C3(C)C)(C)C)O |
Computed by PubChem (NCBI)
Synonyms:
Rhodomyrtosone I, orb1680569