Products 80998-67-0

CAS 80998-67-0 is the registry number for 1,4-Dimethyl 2-sulfamoylbenzene-1,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Dimethyl 2-sulfamoylbenzene-1,4-dicarboxylate (CAS 80998-67-0) is a chemical compound with the molecular formula C10H11NO6S and a molecular weight of 273.26 g/mol. IUPAC name: dimethyl 2-sulfamoylbenzene-1,4-dicarboxylate. InChIKey: KXOAIVMMWXYARA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO6S
Molecular weight273.26 g/mol
IUPAC namedimethyl 2-sulfamoylbenzene-1,4-dicarboxylate
InChIKeyKXOAIVMMWXYARA-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)C(=O)OC)S(=O)(=O)N

Computed by PubChem (NCBI)