CAS 80998-67-0 is the registry number for 1,4-Dimethyl 2-sulfamoylbenzene-1,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Dimethyl 2-sulfamoylbenzene-1,4-dicarboxylate (CAS 80998-67-0) is a chemical compound with the molecular formula C10H11NO6S and a molecular weight of 273.26 g/mol. IUPAC name: dimethyl 2-sulfamoylbenzene-1,4-dicarboxylate. InChIKey: KXOAIVMMWXYARA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6S |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | dimethyl 2-sulfamoylbenzene-1,4-dicarboxylate |
| InChIKey | KXOAIVMMWXYARA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)S(=O)(=O)N |
Computed by PubChem (NCBI)