Products 1404192-78-4
CAS 1404192-78-4 is the registry number for 4,4,5,5-Tetramethyl-2-(1-(p-tolyl)vinyl)-1,3,2-dioxaborolane, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4,4,5,5-tetramethyl-2-[1-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane (CAS 1404192-78-4) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[1-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane. InChIKey: IRVMYTWMAWKUET-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[1-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane |
| InChIKey | IRVMYTWMAWKUET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)