Products 1406216-86-1

CAS 1406216-86-1 is the registry number for 4-(3-(2,2,2-Trifluoroethyl)-1,2,4-oxadiazol-5-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzoic acid (CAS 1406216-86-1) is a chemical compound with the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. IUPAC name: 4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzoic acid. InChIKey: NQUPJTWPUZCXER-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F3N2O3
Molecular weight272.18 g/mol
IUPAC name4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzoic acid
InChIKeyNQUPJTWPUZCXER-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC(=NO2)CC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)