CAS 1406216-86-1 is the registry number for 4-(3-(2,2,2-Trifluoroethyl)-1,2,4-oxadiazol-5-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzoic acid (CAS 1406216-86-1) is a chemical compound with the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. IUPAC name: 4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzoic acid. InChIKey: NQUPJTWPUZCXER-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O3 |
|---|---|
| Molecular weight | 272.18 g/mol |
| IUPAC name | 4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzoic acid |
| InChIKey | NQUPJTWPUZCXER-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NO2)CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)