Products 150649-14-2

CAS 150649-14-2 is the registry number for 4-(5-Oxo-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-[5-oxo-3-(trifluoromethyl)-4H-pyrazol-1-yl]benzoic acid (CAS 150649-14-2) is a chemical compound with the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. IUPAC name: 4-[5-oxo-3-(trifluoromethyl)-4H-pyrazol-1-yl]benzoic acid. InChIKey: YZDQDFGZHALOHA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F3N2O3
Molecular weight272.18 g/mol
IUPAC name4-[5-oxo-3-(trifluoromethyl)-4H-pyrazol-1-yl]benzoic acid
InChIKeyYZDQDFGZHALOHA-UHFFFAOYSA-N
SMILESC1C(=NN(C1=O)C2=CC=C(C=C2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)