CAS 2222512-19-6 is the registry number for 6-Nitro-1-(2,2,2-trifluoroethyl)quinolin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-nitro-1-(2,2,2-trifluoroethyl)quinolin-4-one (CAS 2222512-19-6) is a chemical compound with the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. IUPAC name: 6-nitro-1-(2,2,2-trifluoroethyl)quinolin-4-one. InChIKey: FNQQZCVKCMIFDE-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O3 |
|---|---|
| Molecular weight | 272.18 g/mol |
| IUPAC name | 6-nitro-1-(2,2,2-trifluoroethyl)quinolin-4-one |
| InChIKey | FNQQZCVKCMIFDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)C=CN2CC(F)(F)F |
Computed by PubChem (NCBI)