Products 400744-33-4

CAS 400744-33-4 is the registry number for 3-(5-Hydroxy-3-trifluoromethyl-pyrazol-1-yl)-benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-[3-oxo-5-(trifluoromethyl)-1H-pyrazol-2-yl]benzoic acid (CAS 400744-33-4) is a chemical compound with the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. IUPAC name: 3-[3-oxo-5-(trifluoromethyl)-1H-pyrazol-2-yl]benzoic acid. InChIKey: COUJEZYZSAKAHI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F3N2O3
Molecular weight272.18 g/mol
IUPAC name3-[3-oxo-5-(trifluoromethyl)-1H-pyrazol-2-yl]benzoic acid
InChIKeyCOUJEZYZSAKAHI-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)N2C(=O)C=C(N2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)