CAS 956203-24-0 is the registry number for 4-Hydroxy-1-(2-(trifluoromethyl)phenyl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-hydroxy-1-[2-(trifluoromethyl)phenyl]pyrazole-3-carboxylic acid (CAS 956203-24-0) is a chemical compound with the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. IUPAC name: 4-hydroxy-1-[2-(trifluoromethyl)phenyl]pyrazole-3-carboxylic acid. InChIKey: ZZKLUQPKTQBWJY-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O3 |
|---|---|
| Molecular weight | 272.18 g/mol |
| IUPAC name | 4-hydroxy-1-[2-(trifluoromethyl)phenyl]pyrazole-3-carboxylic acid |
| InChIKey | ZZKLUQPKTQBWJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N2C=C(C(=N2)C(=O)O)O |
Computed by PubChem (NCBI)