Products 14070-56-5

CAS 14070-56-5 is the registry number for Methyl N-(4-sulfamoylphenyl)carbamate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl N-(4-sulfamoylphenyl)carbamate (CAS 14070-56-5) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: methyl N-(4-sulfamoylphenyl)carbamate. InChIKey: JQWKTXIPRZXRJP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O4S
Molecular weight230.24 g/mol
IUPAC namemethyl N-(4-sulfamoylphenyl)carbamate
InChIKeyJQWKTXIPRZXRJP-UHFFFAOYSA-N
SMILESCOC(=O)NC1=CC=C(C=C1)S(=O)(=O)N

Computed by PubChem (NCBI)