CAS 1408074-62-3 appears in our catalog under these names: 4-Ethynyl-2,2-difluoro-1,3-benzodioxole, 95%, 4–Ethynyl–2,2–difluoro–1,3–benzodioxole, 4-Ethynyl-2,2-difluoro-1,3-benzodioxole 98%, 4-Ethynyl-2,2-difluoro-1,3-benzodioxole, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
4-ethynyl-2,2-difluoro-1,3-benzodioxole (CAS 1408074-62-3) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 4-ethynyl-2,2-difluoro-1,3-benzodioxole. InChIKey: QLFBMXCCYXMPFZ-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O2 |
|---|---|
| Molecular weight | 182.12 g/mol |
| IUPAC name | 4-ethynyl-2,2-difluoro-1,3-benzodioxole |
| InChIKey | QLFBMXCCYXMPFZ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C(=CC=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)