CAS 1454686-04-4 appears in our catalog under these names: 5,6–Difluoro–1H–indene–1,3(2H)–dione, 5,6-Difluoro-1H-indene-1,3(2H)-dione 97%, 5,6-Difluoro-1H-indene-1,3(2H)-dione, 98%, 98%, 5,6-Difluoro-1H-indene-1,3(2H)-dione, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g.
5,6-difluoroindene-1,3-dione (CAS 1454686-04-4) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 5,6-difluoroindene-1,3-dione. InChIKey: HDMHJXOJLIYDFU-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O2 |
|---|---|
| Molecular weight | 182.12 g/mol |
| IUPAC name | 5,6-difluoroindene-1,3-dione |
| InChIKey | HDMHJXOJLIYDFU-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC(=C(C=C2C1=O)F)F |
Computed by PubChem (NCBI)