CAS 1551182-90-1 appears in our catalog under these names: 5-Ethynyl-2,2-difluoro-benzo[1,3]dioxole, 95%, 5-Ethynyl-2,2-difluorobenzo(d)(1,3)dioxole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-ethynyl-2,2-difluoro-1,3-benzodioxole (CAS 1551182-90-1) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 5-ethynyl-2,2-difluoro-1,3-benzodioxole. InChIKey: LTIGUJSOOAAZJY-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O2 |
|---|---|
| Molecular weight | 182.12 g/mol |
| IUPAC name | 5-ethynyl-2,2-difluoro-1,3-benzodioxole |
| InChIKey | LTIGUJSOOAAZJY-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)