Products 935475-82-4

CAS 935475-82-4 is the registry number for 3-(3,4-Difluorophenyl)prop-2-ynoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(3,4-difluorophenyl)prop-2-ynoic acid (CAS 935475-82-4) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 3-(3,4-difluorophenyl)prop-2-ynoic acid. InChIKey: FEQWPKHIEVIROK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4F2O2
Molecular weight182.12 g/mol
IUPAC name3-(3,4-difluorophenyl)prop-2-ynoic acid
InChIKeyFEQWPKHIEVIROK-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C#CC(=O)O)F)F

Computed by PubChem (NCBI)