CAS 935475-82-4 is the registry number for 3-(3,4-Difluorophenyl)prop-2-ynoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3,4-difluorophenyl)prop-2-ynoic acid (CAS 935475-82-4) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 3-(3,4-difluorophenyl)prop-2-ynoic acid. InChIKey: FEQWPKHIEVIROK-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O2 |
|---|---|
| Molecular weight | 182.12 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)prop-2-ynoic acid |
| InChIKey | FEQWPKHIEVIROK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#CC(=O)O)F)F |
Computed by PubChem (NCBI)