Products 873075-53-7

CAS 873075-53-7 is the registry number for 3-(2,4-difluorophenyl)prop-2-ynoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-(2,4-difluorophenyl)prop-2-ynoic acid (CAS 873075-53-7) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 3-(2,4-difluorophenyl)prop-2-ynoic acid. InChIKey: VSMONCKOWKICGE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4F2O2
Molecular weight182.12 g/mol
IUPAC name3-(2,4-difluorophenyl)prop-2-ynoic acid
InChIKeyVSMONCKOWKICGE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)F)C#CC(=O)O

Computed by PubChem (NCBI)