CAS 873075-53-7 is the registry number for 3-(2,4-difluorophenyl)prop-2-ynoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(2,4-difluorophenyl)prop-2-ynoic acid (CAS 873075-53-7) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 3-(2,4-difluorophenyl)prop-2-ynoic acid. InChIKey: VSMONCKOWKICGE-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O2 |
|---|---|
| Molecular weight | 182.12 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)prop-2-ynoic acid |
| InChIKey | VSMONCKOWKICGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C#CC(=O)O |
Computed by PubChem (NCBI)