Products 1408291-36-0
CAS 1408291-36-0 is the registry number for 1,5-Dichloro-3-isopropoxyisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,5-dichloro-3-propan-2-yloxyisoquinoline (CAS 1408291-36-0) is a chemical compound with the molecular formula C12H11Cl2NO and a molecular weight of 256.12 g/mol. IUPAC name: 1,5-dichloro-3-propan-2-yloxyisoquinoline. InChIKey: NAMWDAZFTKSDFA-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NO |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 1,5-dichloro-3-propan-2-yloxyisoquinoline |
| InChIKey | NAMWDAZFTKSDFA-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC(=C2C=CC=C(C2=C1)Cl)Cl |
Computed by PubChem (NCBI)