Products 81574-47-2
CAS 81574-47-2 is the registry number for 4-(2-Chlorophenoxy)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-(2-chlorophenoxy)aniline;hydrochloride (CAS 81574-47-2) is a chemical compound with the molecular formula C12H11Cl2NO and a molecular weight of 256.12 g/mol. IUPAC name: 4-(2-chlorophenoxy)aniline;hydrochloride. InChIKey: IMVNZRHEMISKCA-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NO |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 4-(2-chlorophenoxy)aniline;hydrochloride |
| InChIKey | IMVNZRHEMISKCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=CC=C(C=C2)N)Cl.Cl |
Computed by PubChem (NCBI)