CAS 29918-40-9 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)-4,4-dimethyl-5-methylidene-4,5-dihydro-1,3-oxazole, 95%, 2-(3,5-Dichlorophenyl)-4,4-dimethyl-5-methylidene-4,5-dihydro-1,3-oxazole, Propyzamide M1 RH-24644, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: AmBeed, Biosynth, HPC Standards. Available pack sizes: 1g, 2mg, 1mg, 5mg, 10mg, 25mg, 1x1ml.
2-(3,5-dichlorophenyl)-4,4-dimethyl-5-methylidene-1,3-oxazole (CAS 29918-40-9) is a chemical compound with the molecular formula C12H11Cl2NO and a molecular weight of 256.12 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-4,4-dimethyl-5-methylidene-1,3-oxazole. InChIKey: NUHZEWAYELBUEX-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NO |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-4,4-dimethyl-5-methylidene-1,3-oxazole |
| InChIKey | NUHZEWAYELBUEX-UHFFFAOYSA-N |
| SMILES | CC1(C(=C)OC(=N1)C2=CC(=CC(=C2)Cl)Cl)C |
Computed by PubChem (NCBI)