Products 42174-18-5
CAS 42174-18-5 is the registry number for 3-(3,4-dichlorophenyl)-N-prop-2-enylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-3-(3,4-dichlorophenyl)-N-prop-2-enylprop-2-enamide (CAS 42174-18-5) is a chemical compound with the molecular formula C12H11Cl2NO and a molecular weight of 256.12 g/mol. IUPAC name: (E)-3-(3,4-dichlorophenyl)-N-prop-2-enylprop-2-enamide. InChIKey: UUVYTJHNRXQFOC-GQCTYLIASA-N.
| Molecular formula | C12H11Cl2NO |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | (E)-3-(3,4-dichlorophenyl)-N-prop-2-enylprop-2-enamide |
| InChIKey | UUVYTJHNRXQFOC-GQCTYLIASA-N |
| SMILES | C=CCNC(=O)/C=C/C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)