Products 73863-51-1
CAS 73863-51-1 is the registry number for 2-Chloro-3-(2-chloroethyl)-7-methoxyquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-3-(2-chloroethyl)-7-methoxyquinoline (CAS 73863-51-1) is a chemical compound with the molecular formula C12H11Cl2NO and a molecular weight of 256.12 g/mol. IUPAC name: 2-chloro-3-(2-chloroethyl)-7-methoxyquinoline. InChIKey: PTQQTMBBFHOZTL-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NO |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 2-chloro-3-(2-chloroethyl)-7-methoxyquinoline |
| InChIKey | PTQQTMBBFHOZTL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC(=C(C=C2C=C1)CCCl)Cl |
Computed by PubChem (NCBI)