Products 140852-06-8
CAS 140852-06-8 appears in our catalog under these names: 2–Me–D–Trp–OH, H-D-Trp(2-Me)-OH 95%, 2-Me-D-Trp-OH, 95%, 95%, 2-Me-D-Trp-OH, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2R)-2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid (CAS 140852-06-8) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: (2R)-2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid. InChIKey: BXJSOEWOQDVGJW-SNVBAGLBSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | BXJSOEWOQDVGJW-SNVBAGLBSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
2-Me-D-Trp-OH, 2-methyl-d-tryptophan, D-Tryptophan, 2-methyl-, (R)-2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid, (2R)-2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid, H-D-Trp(2-Me)-OH, d-2-methyl-tryptophan, -Tryptophan, 2-methyl-, (R)-2-Amino-3-(2-methyl-3-indolyl)propanoic Acid, (2R)-2-azaniumyl-3-(2-methyl-1H-indol-3-yl)propanoate