Products 21495-41-0
CAS 21495-41-0 appears in our catalog under these names: 2–Amino–3–(2–methyl–1H–indol–3–yl)propanoic acid, 2-Methyl-DL-tryptophan, H-DL-Trp(2-Me)-OH, 95%, 2-Methyl-DL-tryptophan, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 2000mg.
2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid (CAS 21495-41-0) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid. InChIKey: BXJSOEWOQDVGJW-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | BXJSOEWOQDVGJW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)CC(C(=O)O)N |
Computed by PubChem (NCBI)