Products 1409933-13-6

CAS 1409933-13-6 is the registry number for 5-Formyl-1H-indol-3-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(5-formyl-1H-indol-3-yl) acetate (CAS 1409933-13-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: (5-formyl-1H-indol-3-yl) acetate. InChIKey: IXIQLKLECGCGTR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO3
Molecular weight203.19 g/mol
IUPAC name(5-formyl-1H-indol-3-yl) acetate
InChIKeyIXIQLKLECGCGTR-UHFFFAOYSA-N
SMILESCC(=O)OC1=CNC2=C1C=C(C=C2)C=O

Computed by PubChem (NCBI)