CAS 1409933-13-6 is the registry number for 5-Formyl-1H-indol-3-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-formyl-1H-indol-3-yl) acetate (CAS 1409933-13-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: (5-formyl-1H-indol-3-yl) acetate. InChIKey: IXIQLKLECGCGTR-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (5-formyl-1H-indol-3-yl) acetate |
| InChIKey | IXIQLKLECGCGTR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CNC2=C1C=C(C=C2)C=O |
Computed by PubChem (NCBI)