CAS 1409950-69-1 is the registry number for (2E)-3-(2-Fluoro-3-methoxyphenyl)-2-Propenoic Acid. Offered by: TRC. Available pack sizes: 2,5g.
(E)-3-(2-fluoro-3-methoxyphenyl)prop-2-enoic acid (CAS 1409950-69-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (E)-3-(2-fluoro-3-methoxyphenyl)prop-2-enoic acid. InChIKey: XWKXMMLZGWSNHQ-AATRIKPKSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (E)-3-(2-fluoro-3-methoxyphenyl)prop-2-enoic acid |
| InChIKey | XWKXMMLZGWSNHQ-AATRIKPKSA-N |
| SMILES | COC1=CC=CC(=C1F)/C=C/C(=O)O |
Computed by PubChem (NCBI)