CAS 14118-16-2 appears in our catalog under these names: 1,4-Bis(diphenylamino)benzene, 95%, N1,N1,N4,N4-Tetraphenyl-1,4-benzenediamine, 95-<97%, N1,N1,N4,N4-Tetraphenyl-1,4-benzenediamine, ≥97-<99%, N,N,N',N'–Tetraphenyl–1,4–phenylenediamine, N,N,N',N'-Tetraphenyl-1,4-phenylenediamine, >98.0%(GC). Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 25g, 50g, 100g, 200g, 300g, 400g.
1-N,1-N,4-N,4-N-tetraphenylbenzene-1,4-diamine (CAS 14118-16-2) is a chemical compound with the molecular formula C30H24N2 and a molecular weight of 412.5 g/mol. IUPAC name: 1-N,1-N,4-N,4-N-tetraphenylbenzene-1,4-diamine. InChIKey: JPDUPGAVXNALOL-UHFFFAOYSA-N.
| Molecular formula | C30H24N2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 1-N,1-N,4-N,4-N-tetraphenylbenzene-1,4-diamine |
| InChIKey | JPDUPGAVXNALOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)