CAS 167218-30-6 appears in our catalog under these names: N,N,N'–Triphenylbenzidine, N,N,N'-Triphenylbenzidine, >97.0%(GC), N4,N4,N4'-Triphenyl-[1,1'-biphenyl]-4,4'-diamine, 98%, 98%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
N-phenyl-4-[4-(N-phenylanilino)phenyl]aniline (CAS 167218-30-6) is a chemical compound with the molecular formula C30H24N2 and a molecular weight of 412.5 g/mol. IUPAC name: N-phenyl-4-[4-(N-phenylanilino)phenyl]aniline. InChIKey: XHPBZHOZZVRDHL-UHFFFAOYSA-N.
| Molecular formula | C30H24N2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | N-phenyl-4-[4-(N-phenylanilino)phenyl]aniline |
| InChIKey | XHPBZHOZZVRDHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)