CAS 880800-19-1 appears in our catalog under these names: N-Biphenyl-4-yl-N',N'-diphenylbenzene-1,4-diamine 97%, N-Biphenyl-4-yl-N',N'-diphenylbenzene-1,4-diamine, 97%, 97%, N-Biphenyl-4-yl-N',N'-diphenyl-benzene-1,4-diamine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-N,4-N-diphenyl-1-N-(4-phenylphenyl)benzene-1,4-diamine (CAS 880800-19-1) is a chemical compound with the molecular formula C30H24N2 and a molecular weight of 412.5 g/mol. IUPAC name: 4-N,4-N-diphenyl-1-N-(4-phenylphenyl)benzene-1,4-diamine. InChIKey: BMWFGSBSRCFWTA-UHFFFAOYSA-N.
| Molecular formula | C30H24N2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 4-N,4-N-diphenyl-1-N-(4-phenylphenyl)benzene-1,4-diamine |
| InChIKey | BMWFGSBSRCFWTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)