Products 2075795-44-5
CAS 2075795-44-5 is the registry number for 2-Benzhydryl-7'-methyl-1H,1'H-3,3'-biindole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzhydryl-3-(7-methyl-1H-indol-3-yl)-1H-indole (CAS 2075795-44-5) is a chemical compound with the molecular formula C30H24N2 and a molecular weight of 412.5 g/mol. IUPAC name: 2-benzhydryl-3-(7-methyl-1H-indol-3-yl)-1H-indole. InChIKey: QDMDTVRBPJDEAG-UHFFFAOYSA-N.
| Molecular formula | C30H24N2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 2-benzhydryl-3-(7-methyl-1H-indol-3-yl)-1H-indole |
| InChIKey | QDMDTVRBPJDEAG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)C3=C(NC4=CC=CC=C43)C(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)