CAS 1800322-10-4 is the registry number for N1–((1,1'–Biphenyl)–4–yl)–N3,N3–diphenylbenzene–1,3–diamine. Offered by: GLPBio. Available pack sizes: 1g, 5g.
3-N,3-N-diphenyl-1-N-(4-phenylphenyl)benzene-1,3-diamine (CAS 1800322-10-4) is a chemical compound with the molecular formula C30H24N2 and a molecular weight of 412.5 g/mol. IUPAC name: 3-N,3-N-diphenyl-1-N-(4-phenylphenyl)benzene-1,3-diamine. InChIKey: CRAKIPJUCBZTDP-UHFFFAOYSA-N.
| Molecular formula | C30H24N2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 3-N,3-N-diphenyl-1-N-(4-phenylphenyl)benzene-1,3-diamine |
| InChIKey | CRAKIPJUCBZTDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC(=CC=C3)N(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)