CAS 141236-46-6 is the registry number for 3-(3,4-Dimethoxyphenyl)prop-2-enoyl chloride. Offered by: Biosynth. Available pack sizes: 2,5g.
(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl chloride (CAS 141236-46-6) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: (E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl chloride. InChIKey: HGDZRSNJGRIAKS-GQCTYLIASA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl chloride |
| InChIKey | HGDZRSNJGRIAKS-GQCTYLIASA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)Cl)OC |
Computed by PubChem (NCBI)