CAS 1412431-03-8 is the registry number for 3-[4-(Aminocarbonyl)phenoxy]benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-(4-carbamoylphenoxy)benzoic acid (CAS 1412431-03-8) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-(4-carbamoylphenoxy)benzoic acid. InChIKey: ICNVAPHYZVNZIX-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-(4-carbamoylphenoxy)benzoic acid |
| InChIKey | ICNVAPHYZVNZIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)