Products 1412431-03-8

CAS 1412431-03-8 is the registry number for 3-[4-(Aminocarbonyl)phenoxy]benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-(4-carbamoylphenoxy)benzoic acid (CAS 1412431-03-8) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-(4-carbamoylphenoxy)benzoic acid. InChIKey: ICNVAPHYZVNZIX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11NO4
Molecular weight257.24 g/mol
IUPAC name3-(4-carbamoylphenoxy)benzoic acid
InChIKeyICNVAPHYZVNZIX-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OC2=CC=C(C=C2)C(=O)N)C(=O)O

Computed by PubChem (NCBI)