CAS 141268-32-8 appears in our catalog under these names: 2-Chloro-4-ethyl-quinoline, 95%, 2-Chloro-4-ethylquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-4-ethylquinoline (CAS 141268-32-8) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 2-chloro-4-ethylquinoline. InChIKey: LOODJQDXUVJVRG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 2-chloro-4-ethylquinoline |
| InChIKey | LOODJQDXUVJVRG-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=NC2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)