CAS 141302-38-7 is the registry number for 3-Bromo-5,7-dimethoxyquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,7-dimethoxyquinoline (CAS 141302-38-7) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 3-bromo-5,7-dimethoxyquinoline. InChIKey: OXRWGQZUXGPUNL-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 3-bromo-5,7-dimethoxyquinoline |
| InChIKey | OXRWGQZUXGPUNL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(C=N2)Br)C(=C1)OC |
Computed by PubChem (NCBI)