CAS 6989-21-5 is the registry number for Atractylone, 98%. Offered by: AmBeed. Available pack sizes: 10mg.
(4aS,8aR)-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran (CAS 6989-21-5) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: (4aS,8aR)-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran. InChIKey: TYPSVDGIQAOBAD-DZGCQCFKSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (4aS,8aR)-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran |
| InChIKey | TYPSVDGIQAOBAD-DZGCQCFKSA-N |
| SMILES | CC1=COC2=C1C[C@H]3C(=C)CCC[C@@]3(C2)C |
Computed by PubChem (NCBI)