CAS 6989-21-5 appears in our catalog under these names: Atractylone, 98%, (4aS,8aR)-3,8a-Dimethyl-5-methylene-4,4a,5,6,7,8,8a,9-octahydronaphtho[2,3-b]furan, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 10mg, 50mg, 100mg.
(4aS,8aR)-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran (CAS 6989-21-5) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: (4aS,8aR)-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran. InChIKey: TYPSVDGIQAOBAD-DZGCQCFKSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (4aS,8aR)-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran |
| InChIKey | TYPSVDGIQAOBAD-DZGCQCFKSA-N |
| SMILES | CC1=COC2=C1C[C@H]3C(=C)CCC[C@@]3(C2)C |
Computed by PubChem (NCBI)