Products 141395-49-5
CAS 141395-49-5 is the registry number for 2-Deoxy-2-fluoro-D-mannopyranose Tetraacetate. Offered by: TRC. Available pack sizes: 500mg.
[(2R,3R,4S,5S)-3,4,6-triacetyloxy-5-fluorooxan-2-yl]methyl acetate (CAS 141395-49-5) is a chemical compound with the molecular formula C14H19FO9 and a molecular weight of 350.29 g/mol. IUPAC name: [(2R,3R,4S,5S)-3,4,6-triacetyloxy-5-fluorooxan-2-yl]methyl acetate. InChIKey: KIPRSJXOVDEYLX-DYPLGBCKSA-N.
| Molecular formula | C14H19FO9 |
|---|---|
| Molecular weight | 350.29 g/mol |
| IUPAC name | [(2R,3R,4S,5S)-3,4,6-triacetyloxy-5-fluorooxan-2-yl]methyl acetate |
| InChIKey | KIPRSJXOVDEYLX-DYPLGBCKSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H](C(O1)OC(=O)C)F)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)