Products 83697-45-4

CAS 83697-45-4 is the registry number for 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-fluoro-D-galactopyranose. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg.

Structural formula: {0} (CAS {1})

(3,4,6-triacetyloxy-5-fluorooxan-2-yl)methyl acetate (CAS 83697-45-4) is a chemical compound with the molecular formula C14H19FO9 and a molecular weight of 350.29 g/mol. IUPAC name: (3,4,6-triacetyloxy-5-fluorooxan-2-yl)methyl acetate. InChIKey: KIPRSJXOVDEYLX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19FO9
Molecular weight350.29 g/mol
IUPAC name(3,4,6-triacetyloxy-5-fluorooxan-2-yl)methyl acetate
InChIKeyKIPRSJXOVDEYLX-UHFFFAOYSA-N
SMILESCC(=O)OCC1C(C(C(C(O1)OC(=O)C)F)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)