CAS 3934-29-0 appears in our catalog under these names: 2,3,4,6-Tetra-o-acetyl-alpha-d-glucopyranosyl fluoride, 98%, 2,3,4,6–Tetra–O–acetyl–α–D–glucopyranosyl fluoride, 2,3,4,6-Tetra-O-Acetyl-α-D-Glucopyranosyl Fluoride, 2,3,4,6-Tetra-O-acetyl-alpha-D-glucopyranosyl Fluoride, >98.0%(GC), 2,3,4,6-Tetra-O-acetyl-α-D-glucopyranosyl fluoride 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 2g, 100mg, 250mg.
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-fluorooxan-2-yl]methyl acetate (CAS 3934-29-0) is a chemical compound with the molecular formula C14H19FO9 and a molecular weight of 350.29 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-fluorooxan-2-yl]methyl acetate. InChIKey: JJXATNWYELAACC-RGDJUOJXSA-N.
| Molecular formula | C14H19FO9 |
|---|---|
| Molecular weight | 350.29 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-fluorooxan-2-yl]methyl acetate |
| InChIKey | JJXATNWYELAACC-RGDJUOJXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)F)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)