CAS 262607-48-7 appears in our catalog under these names: (3R,4S,5S,6R)–6–(acetoxymethyl)–3–fluorotetrahydro–2H–pyran–2,4,5–triyl triacetate, 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-fluoro-D-galactopyranose. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
[(2R,3S,4S,5R)-3,4,6-triacetyloxy-5-fluorooxan-2-yl]methyl acetate (CAS 262607-48-7) is a chemical compound with the molecular formula C14H19FO9 and a molecular weight of 350.29 g/mol. IUPAC name: [(2R,3S,4S,5R)-3,4,6-triacetyloxy-5-fluorooxan-2-yl]methyl acetate. InChIKey: KIPRSJXOVDEYLX-RQICVUQASA-N.
| Molecular formula | C14H19FO9 |
|---|---|
| Molecular weight | 350.29 g/mol |
| IUPAC name | [(2R,3S,4S,5R)-3,4,6-triacetyloxy-5-fluorooxan-2-yl]methyl acetate |
| InChIKey | KIPRSJXOVDEYLX-RQICVUQASA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)OC(=O)C)F)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)