CAS 2823-44-1 appears in our catalog under these names: 2,3,4,6-Tetra-o-acetyl-alpha-d-mannopyranosyl fluoride, 98%, Tetra–O–acetyl–α–D–mannopyranosyl fluoride, 2,3,4,6-Tetra-O-Acetyl-α-D-Mannopyranosyl Fluoride, 2,3,4,6-Tetra-O-acetyl-a-D-mannopyranosyl fluoride, Acetofluoro-α-D-mannose 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 50g, 250g, 1000g, 500g.
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-fluorooxan-2-yl]methyl acetate (CAS 2823-44-1) is a chemical compound with the molecular formula C14H19FO9 and a molecular weight of 350.29 g/mol. IUPAC name: [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-fluorooxan-2-yl]methyl acetate. InChIKey: JJXATNWYELAACC-DGTMBMJNSA-N.
| Molecular formula | C14H19FO9 |
|---|---|
| Molecular weight | 350.29 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-fluorooxan-2-yl]methyl acetate |
| InChIKey | JJXATNWYELAACC-DGTMBMJNSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)F)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)