Products 1552698-76-6
CAS 1552698-76-6 appears in our catalog under these names: tert-Butyl 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate, 95%, tert-Butyl 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Tert-butyl 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (CAS 1552698-76-6) is a chemical compound with the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. IUPAC name: tert-butyl 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate. InChIKey: VSZGOMPRQXZCIW-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2S |
|---|---|
| Molecular weight | 267.39 g/mol |
| IUPAC name | tert-butyl 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| InChIKey | VSZGOMPRQXZCIW-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)SC(=C2C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)