CAS 141468-55-5 is the registry number for (S)-tert-Butyl 4-isopropyl-2,5-dioxooxazolidine-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl (4S)-2,5-dioxo-4-propan-2-yl-1,3-oxazolidine-3-carboxylate (CAS 141468-55-5) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: tert-butyl (4S)-2,5-dioxo-4-propan-2-yl-1,3-oxazolidine-3-carboxylate. InChIKey: RTIIPUBJZYTAMU-ZETCQYMHSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | tert-butyl (4S)-2,5-dioxo-4-propan-2-yl-1,3-oxazolidine-3-carboxylate |
| InChIKey | RTIIPUBJZYTAMU-ZETCQYMHSA-N |
| SMILES | CC(C)[C@H]1C(=O)OC(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)