CAS 1414960-64-7 appears in our catalog under these names: (R)-5-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 96%, (R)–5–Bromo–2，3–dihydrobenzofuran–3–amine hydrochloride, (R)-5-Bromo-2,3-dihydro-benzofuran-3-ylamine hydrochloride ee. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 100mg, 0,5g, 50mg.
(3R)-5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1414960-64-7) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: (3R)-5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: UKCIFENUZLYBRF-FJXQXJEOSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | (3R)-5-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | UKCIFENUZLYBRF-FJXQXJEOSA-N |
| SMILES | C1[C@@H](C2=C(O1)C=CC(=C2)Br)N.Cl |
Computed by PubChem (NCBI)