Products 1415018-78-8
CAS 1415018-78-8 appears in our catalog under these names: (S)-Fmoc-3-methyl-piperidine-3-carboxylic acid, 95%, (S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-3-methylpiperidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-methylpiperidine-3-carboxylic acid (CAS 1415018-78-8) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-methylpiperidine-3-carboxylic acid. InChIKey: NANBTYVNWVGYFU-QFIPXVFZSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-methylpiperidine-3-carboxylic acid |
| InChIKey | NANBTYVNWVGYFU-QFIPXVFZSA-N |
| SMILES | C[C@@]1(CCCN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)